C44H28N4O2 — CID 10651777
3-(10,15,20-triphenyl-23,24-dihydroporphyrin-5-yl)cyclohexa-3,5-diene-1,2-dione (PubChem CID 10651777) has the molecular formula C44H28N4O2 and a molecular weight of 644.73 g/mol. Its IUPAC name is 3-(10,15,20-triphenyl-23,24-dihydroporphyrin-5-yl)cyclohexa-3,5-diene-1,2-dione.
| Compound Name | 3-(10,15,20-triphenyl-23,24-dihydroporphyrin-5-yl)cyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 10651777 |
| Molecular Formula | C44H28N4O2 |
| Molecular Weight | 644.73 g/mol |
| Exact Mass | 644.22 |
| IUPAC Name | 3-(10,15,20-triphenyl-23,24-dihydroporphyrin-5-yl)cyclohexa-3,5-diene-1,2-dione |
| SMILES | O=C1C=CC=C(c2c3nc(c(-c4ccccc4)c4ccc([nH]4)c(-c4ccccc4)c4ccc([nH]4)c(-c4ccccc4)c4nc2C=C4)C=C3)C1=O |
| InChI | InChI=1S/C44H28N4O2/c49-39-18-10-17-30(44(39)50)43-37-25-23-35(47-37)41(28-13-6-2-7-14-28)33-21-19-31(45-33)40(27-11-4-1-5-12-27)32-20-22-34(46-32)42(29-15-8-3-9-16-29)36-24-26-38(43)48-36/h1-26,45-46H/b40-31-,40-32-,41-33-,41-35-,42-34-,42-36-,43-37-,43-38- |
| InChIKey | DWVRKHLGJAEZAM-JZEBFADFSA-N |
| XLogP | 9.75 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.73 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|