C34H20F6N4 — CID 10723040
10,20-diphenyl-5,15-bis(trifluoromethyl)-21,22-dihydroporphyrin (PubChem CID 10723040) has the molecular formula C34H20F6N4 and a molecular weight of 598.55 g/mol. Its IUPAC name is 10,20-diphenyl-5,15-bis(trifluoromethyl)-21,22-dihydroporphyrin.
| Compound Name | 10,20-diphenyl-5,15-bis(trifluoromethyl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 10723040 |
| Molecular Formula | C34H20F6N4 |
| Molecular Weight | 598.55 g/mol |
| Exact Mass | 598.16 |
| IUPAC Name | 10,20-diphenyl-5,15-bis(trifluoromethyl)-21,22-dihydroporphyrin |
| SMILES | FC(F)(F)c1c2nc(c(-c3ccccc3)c3ccc([nH]3)c(C(F)(F)F)c3ccc([nH]3)c(-c3ccccc3)c3nc1C=C3)C=C2 |
| InChI | InChI=1S/C34H20F6N4/c35-33(36,37)31-25-15-11-21(41-25)29(19-7-3-1-4-8-19)22-12-16-26(42-22)32(34(38,39)40)28-18-14-24(44-28)30(20-9-5-2-6-10-20)23-13-17-27(31)43-23/h1-18,41,43H/b29-21-,29-22-,30-23-,30-24-,31-25+,31-27+,32-26+,32-28+ |
| InChIKey | LZQZQJTUVXHCLC-IBRKNYKGSA-N |
| XLogP | 10.03 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.55 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |