C38H20BrF13N4 — CID 11665098
5-bromo-10,20-diphenyl-15-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-21,22-dihydroporphyrin (PubChem CID 11665098) has the molecular formula C38H20BrF13N4 and a molecular weight of 859.48 g/mol. Its IUPAC name is 5-bromo-10,20-diphenyl-15-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-21,22-dihydroporphyrin.
| Compound Name | 5-bromo-10,20-diphenyl-15-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 11665098 |
| Molecular Formula | C38H20BrF13N4 |
| Molecular Weight | 859.48 g/mol |
| Exact Mass | 858.07 |
| IUPAC Name | 5-bromo-10,20-diphenyl-15-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-21,22-dihydroporphyrin |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)c1c2nc(c(-c3ccccc3)c3ccc([nH]3)c(Br)c3ccc([nH]3)c(-c3ccccc3)c3nc1C=C3)C=C2 |
| InChI | InChI=1S/C38H20BrF13N4/c39-32-27-17-13-23(55-27)29(19-7-3-1-4-8-19)21-11-15-25(53-21)31(33(40,41)34(42,43)35(44,45)36(46,47)37(48,49)38(50,51)52)26-16-12-22(54-26)30(20-9-5-2-6-10-20)24-14-18-28(32)56-24/h1-18,55-56H/b29-21-,29-23-,30-22-,30-24-,31-25+,31-26+,32-27+,32-28+ |
| InChIKey | UQCMEJGBDACTTP-KMJDNXKBSA-N |
| XLogP | 12.95 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.48 |
| LogP ≤ 5 | 12.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|