C48H29F9N4 — CID 11029223
2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-5,10,15,20-tetraphenyl-21,22-dihydroporphyrin (PubChem CID 11029223) has the molecular formula C48H29F9N4 and a molecular weight of 832.77 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-5,10,15,20-tetraphenyl-21,22-dihydroporphyrin.
| Compound Name | 2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-5,10,15,20-tetraphenyl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 11029223 |
| Molecular Formula | C48H29F9N4 |
| Molecular Weight | 832.77 g/mol |
| Exact Mass | 832.22 |
| IUPAC Name | 2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-5,10,15,20-tetraphenyl-21,22-dihydroporphyrin |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)c1cc2[nH]c1c(-c1ccccc1)c1nc(c(-c3ccccc3)c3nc(c(-c4ccccc4)c4ccc([nH]4)c2-c2ccccc2)C=C3)C=C1 |
| InChI | InChI=1S/C48H29F9N4/c49-45(50,46(51,52)47(53,54)48(55,56)57)32-27-39-42(30-17-9-3-10-18-30)37-24-23-35(59-37)40(28-13-5-1-6-14-28)33-21-22-34(58-33)41(29-15-7-2-8-16-29)36-25-26-38(60-36)43(44(32)61-39)31-19-11-4-12-20-31/h1-27,59,61H/b40-33-,40-35-,41-34-,41-36-,42-37-,42-39-,43-38-,44-43- |
| InChIKey | YUKZLEZLKSAAQG-FGSSQFOESA-N |
| XLogP | 14.25 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.77 |
| LogP ≤ 5 | 14.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|