C40H21F13N4 — CID 11643613
15-ethynyl-10,20-diphenyl-5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-21,22-dihydroporphyrin (PubChem CID 11643613) has the molecular formula C40H21F13N4 and a molecular weight of 804.61 g/mol. Its IUPAC name is 15-ethynyl-10,20-diphenyl-5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-21,22-dihydroporphyrin.
| Compound Name | 15-ethynyl-10,20-diphenyl-5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 11643613 |
| Molecular Formula | C40H21F13N4 |
| Molecular Weight | 804.61 g/mol |
| Exact Mass | 804.16 |
| IUPAC Name | 15-ethynyl-10,20-diphenyl-5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-21,22-dihydroporphyrin |
| SMILES | C#Cc1c2nc(c(-c3ccccc3)c3ccc([nH]3)c(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c3ccc([nH]3)c(-c3ccccc3)c3nc1C=C3)C=C2 |
| InChI | InChI=1S/C40H21F13N4/c1-2-23-24-13-15-26(54-24)32(21-9-5-3-6-10-21)28-17-19-30(56-28)34(35(41,42)36(43,44)37(45,46)38(47,48)39(49,50)40(51,52)53)31-20-18-29(57-31)33(22-11-7-4-8-12-22)27-16-14-25(23)55-27/h1,3-20,56-57H/b24-23-,25-23-,32-26-,32-28-,33-27-,33-29-,34-30+,34-31+ |
| InChIKey | IAGSATSJMWZJAW-MZHJDPSRSA-N |
| XLogP | 12.17 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.61 |
| LogP ≤ 5 | 12.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|