C33H21F3N4 — CID 11497978
10,20-diphenyl-15-(trifluoromethyl)-21,22-dihydroporphyrin (PubChem CID 11497978) has the molecular formula C33H21F3N4 and a molecular weight of 530.55 g/mol. Its IUPAC name is 10,20-diphenyl-15-(trifluoromethyl)-21,22-dihydroporphyrin.
| Compound Name | 10,20-diphenyl-15-(trifluoromethyl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 11497978 |
| Molecular Formula | C33H21F3N4 |
| Molecular Weight | 530.55 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | 10,20-diphenyl-15-(trifluoromethyl)-21,22-dihydroporphyrin |
| SMILES | FC(F)(F)c1c2nc(c(-c3ccccc3)c3ccc(cc4ccc([nH]4)c(-c4ccccc4)c4nc1C=C4)[nH]3)C=C2 |
| InChI | InChI=1S/C33H21F3N4/c34-33(35,36)32-28-17-15-26(39-28)30(20-7-3-1-4-8-20)24-13-11-22(37-24)19-23-12-14-25(38-23)31(21-9-5-2-6-10-21)27-16-18-29(32)40-27/h1-19,37-38H/b22-19-,23-19-,30-24-,30-26-,31-25-,31-27-,32-28+,32-29+ |
| InChIKey | SNILGTBPTCRGKJ-BRZPQLSBSA-N |
| XLogP | 9.01 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.55 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |