C42H25ClF4N4 — CID 11556794
15-(2-chloro-1,1,2,2-tetrafluoroethyl)-10,20-diphenyl-3-(2-phenylethynyl)-21,22-dihydroporphyrin (PubChem CID 11556794) has the molecular formula C42H25ClF4N4 and a molecular weight of 697.14 g/mol. Its IUPAC name is 15-(2-chloro-1,1,2,2-tetrafluoroethyl)-10,20-diphenyl-3-(2-phenylethynyl)-21,22-dihydroporphyrin.
| Compound Name | 15-(2-chloro-1,1,2,2-tetrafluoroethyl)-10,20-diphenyl-3-(2-phenylethynyl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 11556794 |
| Molecular Formula | C42H25ClF4N4 |
| Molecular Weight | 697.14 g/mol |
| Exact Mass | 696.17 |
| IUPAC Name | 15-(2-chloro-1,1,2,2-tetrafluoroethyl)-10,20-diphenyl-3-(2-phenylethynyl)-21,22-dihydroporphyrin |
| SMILES | FC(F)(Cl)C(F)(F)c1c2nc(c(-c3ccccc3)c3ccc(cc4[nH]c(cc4C#Cc4ccccc4)c(-c4ccccc4)c4nc1C=C4)[nH]3)C=C2 |
| InChI | InChI=1S/C42H25ClF4N4/c43-42(46,47)41(44,45)40-34-22-20-32(49-34)38(27-12-6-2-7-13-27)31-19-18-30(48-31)25-36-29(17-16-26-10-4-1-5-11-26)24-37(51-36)39(28-14-8-3-9-15-28)33-21-23-35(40)50-33/h1-15,18-25,48,51H/b30-25-,36-25-,38-31-,38-32-,39-33-,39-37-,40-34+,40-35+ |
| InChIKey | UXJUFPGJAMBOGI-QJUXEOOISA-N |
| XLogP | 11.31 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.14 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|