C55H40N4 — CID 10350158
10,15,20-tris(4-methylphenyl)-5-[3-(2-phenylethynyl)phenyl]-21,22-dihydroporphyrin (PubChem CID 10350158) has the molecular formula C55H40N4 and a molecular weight of 756.95 g/mol. Its IUPAC name is 10,15,20-tris(4-methylphenyl)-5-[3-(2-phenylethynyl)phenyl]-21,22-dihydroporphyrin.
| Compound Name | 10,15,20-tris(4-methylphenyl)-5-[3-(2-phenylethynyl)phenyl]-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 10350158 |
| Molecular Formula | C55H40N4 |
| Molecular Weight | 756.95 g/mol |
| Exact Mass | 756.33 |
| IUPAC Name | 10,15,20-tris(4-methylphenyl)-5-[3-(2-phenylethynyl)phenyl]-21,22-dihydroporphyrin |
| SMILES | Cc1ccc(-c2c3nc(c(-c4ccc(C)cc4)c4ccc([nH]4)c(-c4cccc(C#Cc5ccccc5)c4)c4ccc([nH]4)c(-c4ccc(C)cc4)c4nc2C=C4)C=C3)cc1 |
| InChI | InChI=1S/C55H40N4/c1-35-12-20-40(21-13-35)52-44-26-28-46(56-44)53(41-22-14-36(2)15-23-41)48-30-32-50(58-48)55(43-11-7-10-39(34-43)19-18-38-8-5-4-6-9-38)51-33-31-49(59-51)54(47-29-27-45(52)57-47)42-24-16-37(3)17-25-42/h4-17,20-34,58-59H,1-3H3/b52-44-,52-45-,53-46-,53-48-,54-47-,54-49-,55-50-,55-51- |
| InChIKey | AAVRPACTAFWPBY-DHSWGDOPSA-N |
| XLogP | 13.65 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.95 |
| LogP ≤ 5 | 13.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|