C59H40N4O — CID 10581510
4-[3-ethynyl-5-[2-[4-(10,15,20-triphenyl-23,24-dihydroporphyrin-5-yl)phenyl]ethynyl]phenyl]-2-methylbut-3-yn-2-ol (PubChem CID 10581510) has the molecular formula C59H40N4O and a molecular weight of 821.00 g/mol. Its IUPAC name is 4-[3-ethynyl-5-[2-[4-(10,15,20-triphenyl-23,24-dihydroporphyrin-5-yl)phenyl]ethynyl]phenyl]-2-methylbut-3-yn-2-ol.
| Compound Name | 4-[3-ethynyl-5-[2-[4-(10,15,20-triphenyl-23,24-dihydroporphyrin-5-yl)phenyl]ethynyl]phenyl]-2-methylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 10581510 |
| Molecular Formula | C59H40N4O |
| Molecular Weight | 821.00 g/mol |
| Exact Mass | 820.32 |
| IUPAC Name | 4-[3-ethynyl-5-[2-[4-(10,15,20-triphenyl-23,24-dihydroporphyrin-5-yl)phenyl]ethynyl]phenyl]-2-methylbut-3-yn-2-ol |
| SMILES | C#Cc1cc(C#Cc2ccc(-c3c4nc(c(-c5ccccc5)c5ccc([nH]5)c(-c5ccccc5)c5ccc([nH]5)c(-c5ccccc5)c5nc3C=C5)C=C4)cc2)cc(C#CC(C)(C)O)c1 |
| InChI | InChI=1S/C59H40N4O/c1-4-39-36-41(38-42(37-39)34-35-59(2,3)64)21-20-40-22-24-46(25-23-40)58-53-32-30-51(62-53)56(44-16-10-6-11-17-44)49-28-26-47(60-49)55(43-14-8-5-9-15-43)48-27-29-50(61-48)57(45-18-12-7-13-19-45)52-31-33-54(58)63-52/h1,5-19,22-33,36-38,60-61,64H,2-3H3/b55-47-,55-48-,56-49-,56-51-,57-50-,57-52-,58-53-,58-54- |
| InChIKey | HYUXMOPCUROMDN-MXRZNNOWSA-N |
| XLogP | 12.83 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.00 |
| LogP ≤ 5 | 12.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|