C52H42N4O — CID 11411606
2-methyl-4-[4-[10,15,20-tris(4-methylphenyl)-21,22-dihydroporphyrin-5-yl]phenyl]but-3-yn-2-ol (PubChem CID 11411606) has the molecular formula C52H42N4O and a molecular weight of 738.93 g/mol. Its IUPAC name is 2-methyl-4-[4-[10,15,20-tris(4-methylphenyl)-21,22-dihydroporphyrin-5-yl]phenyl]but-3-yn-2-ol.
| Compound Name | 2-methyl-4-[4-[10,15,20-tris(4-methylphenyl)-21,22-dihydroporphyrin-5-yl]phenyl]but-3-yn-2-ol |
|---|---|
| PubChem CID | 11411606 |
| Molecular Formula | C52H42N4O |
| Molecular Weight | 738.93 g/mol |
| Exact Mass | 738.34 |
| IUPAC Name | 2-methyl-4-[4-[10,15,20-tris(4-methylphenyl)-21,22-dihydroporphyrin-5-yl]phenyl]but-3-yn-2-ol |
| SMILES | Cc1ccc(-c2c3nc(c(-c4ccc(C)cc4)c4ccc([nH]4)c(-c4ccc(C#CC(C)(C)O)cc4)c4ccc([nH]4)c(-c4ccc(C)cc4)c4nc2C=C4)C=C3)cc1 |
| InChI | InChI=1S/C52H42N4O/c1-32-6-14-36(15-7-32)48-40-22-24-42(53-40)49(37-16-8-33(2)9-17-37)44-26-28-46(55-44)51(39-20-12-35(13-21-39)30-31-52(4,5)57)47-29-27-45(56-47)50(43-25-23-41(48)54-43)38-18-10-34(3)11-19-38/h6-29,55-57H,1-5H3/b48-40-,48-41-,49-42-,49-44-,50-43-,50-45-,51-46-,51-47- |
| InChIKey | IMPFEENUMGBUOY-PRWUXVGQSA-N |
| XLogP | 12.37 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.93 |
| LogP ≤ 5 | 12.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|