C58H52N4OZn — CID 16742250
zinc 2-methyl-4-[4-[10,15,20-tris(2,4,6-trimethylphenyl)porphyrin-23,24-diid-5-yl]phenyl]but-3-yn-2-ol (PubChem CID 16742250) has the molecular formula C58H52N4OZn and a molecular weight of 887.46 g/mol. Its IUPAC name is zinc 2-methyl-4-[4-[10,15,20-tris(2,4,6-trimethylphenyl)porphyrin-23,24-diid-5-yl]phenyl]but-3-yn-2-ol.
| Compound Name | zinc 2-methyl-4-[4-[10,15,20-tris(2,4,6-trimethylphenyl)porphyrin-23,24-diid-5-yl]phenyl]but-3-yn-2-ol |
|---|---|
| PubChem CID | 16742250 |
| Molecular Formula | C58H52N4OZn |
| Molecular Weight | 887.46 g/mol |
| Exact Mass | 885.35 |
| IUPAC Name | zinc 2-methyl-4-[4-[10,15,20-tris(2,4,6-trimethylphenyl)porphyrin-23,24-diid-5-yl]phenyl]but-3-yn-2-ol |
| SMILES | Cc1cc(C)c(-c2c3nc([13c](-c4ccc(C#CC(C)(C)O)cc4)c4nc(c(-c5c(C)cc(C)cc5C)c5ccc([n-]5)c(-c5c(C)cc(C)cc5C)c5ccc2[n-]5)C=C4)C=C3)c(C)c1.[Zn+2] |
| InChI | InChI=1S/C58H52N4O.Zn/c1-32-26-35(4)51(36(5)27-32)55-45-18-16-43(59-45)54(42-14-12-41(13-15-42)24-25-58(10,11)63)44-17-19-46(60-44)56(52-37(6)28-33(2)29-38(52)7)48-21-23-50(62-48)57(49-22-20-47(55)61-49)53-39(8)30-34(3)31-40(53)9;/h12-23,26-31,63H,1-11H3;/q-2;+2/b54-43-,54-44-,55-45+,55-47+,56-46+,56-48+,57-49+,57-50+;/i54+1; |
| InChIKey | NCWATPGSLVKFOB-JCLGLXHNSA-N |
| XLogP | 13.48 |
| TPSA | 74.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 887.46 |
| LogP ≤ 5 | 13.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|