C53H47N4O3PZn — CID 58763684
zinc [4-[10,15,20-tris(2,4,6-trimethylphenyl)porphyrin-22,24-diid-5-yl]phenyl]phosphonic acid (PubChem CID 58763684) has the molecular formula C53H47N4O3PZn and a molecular weight of 884.35 g/mol. Its IUPAC name is zinc [4-[10,15,20-tris(2,4,6-trimethylphenyl)porphyrin-22,24-diid-5-yl]phenyl]phosphonic acid.
| Compound Name | zinc [4-[10,15,20-tris(2,4,6-trimethylphenyl)porphyrin-22,24-diid-5-yl]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 58763684 |
| Molecular Formula | C53H47N4O3PZn |
| Molecular Weight | 884.35 g/mol |
| Exact Mass | 882.27 |
| IUPAC Name | zinc [4-[10,15,20-tris(2,4,6-trimethylphenyl)porphyrin-22,24-diid-5-yl]phenyl]phosphonic acid |
| SMILES | Cc1cc(C)c(-c2c3nc(c(-c4c(C)cc(C)cc4C)c4ccc([n-]4)c(-c4c(C)cc(C)cc4C)c4nc(c(-c5ccc(P(=O)(O)O)cc5)c5ccc2[n-]5)C=C4)C=C3)c(C)c1.[Zn+2] |
| InChI | InChI=1S/C53H47N4O3P.Zn/c1-28-22-31(4)47(32(5)23-28)51-41-16-14-39(54-41)50(37-10-12-38(13-11-37)61(58,59)60)40-15-17-42(55-40)52(48-33(6)24-29(2)25-34(48)7)44-19-21-46(57-44)53(45-20-18-43(51)56-45)49-35(8)26-30(3)27-36(49)9;/h10-27H,1-9H3,(H2,58,59,60);/q-2;+2/b50-39-,50-40-,51-41+,51-43+,52-42+,52-44+,53-45+,53-46+; |
| InChIKey | DNDIVDWHGQYBNE-ICRMOVKOSA-N |
| XLogP | 12.16 |
| TPSA | 111.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.35 |
| LogP ≤ 5 | 12.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|