C48H36N4Os — CID 10213009
osmium(2+);5,10,15,20-tetrakis(4-methylphenyl)porphyrin-22,24-diide (PubChem CID 10213009) has the molecular formula C48H36N4Os and a molecular weight of 859.07 g/mol. Its IUPAC name is osmium(2+);5,10,15,20-tetrakis(4-methylphenyl)porphyrin-22,24-diide.
| Compound Name | osmium(2+);5,10,15,20-tetrakis(4-methylphenyl)porphyrin-22,24-diide |
|---|---|
| PubChem CID | 10213009 |
| Molecular Formula | C48H36N4Os |
| Molecular Weight | 859.07 g/mol |
| Exact Mass | 860.26 |
| IUPAC Name | osmium(2+);5,10,15,20-tetrakis(4-methylphenyl)porphyrin-22,24-diide |
| SMILES | Cc1ccc(-c2c3nc(c(-c4ccc(C)cc4)c4ccc([n-]4)c(-c4ccc(C)cc4)c4nc(c(-c5ccc(C)cc5)c5ccc2[n-]5)C=C4)C=C3)cc1.[Os+2] |
| InChI | InChI=1S/C48H36N4.Os/c1-29-5-13-33(14-6-29)45-37-21-23-39(49-37)46(34-15-7-30(2)8-16-34)41-25-27-43(51-41)48(36-19-11-32(4)12-20-36)44-28-26-42(52-44)47(40-24-22-38(45)50-40)35-17-9-31(3)10-18-35;/h5-28H,1-4H3;/q-2;+2/b45-37-,45-38-,46-39-,46-41-,47-40-,47-42-,48-43-,48-44-; |
| InChIKey | ARWNZTFUAFPRHY-NHZJRHMYSA-N |
| XLogP | 11.81 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.07 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |