C44H32CuN8 — CID 154728535
copper 4-[10,15,20-tris(4-aminophenyl)porphyrin-22,24-diid-5-yl]aniline (PubChem CID 154728535) has the molecular formula C44H32CuN8 and a molecular weight of 736.34 g/mol. Its IUPAC name is copper 4-[10,15,20-tris(4-aminophenyl)porphyrin-22,24-diid-5-yl]aniline.
| Compound Name | copper 4-[10,15,20-tris(4-aminophenyl)porphyrin-22,24-diid-5-yl]aniline |
|---|---|
| PubChem CID | 154728535 |
| Molecular Formula | C44H32CuN8 |
| Molecular Weight | 736.34 g/mol |
| Exact Mass | 735.20 |
| IUPAC Name | copper 4-[10,15,20-tris(4-aminophenyl)porphyrin-22,24-diid-5-yl]aniline |
| SMILES | Nc1ccc(-c2c3nc(c(-c4ccc(N)cc4)c4ccc([n-]4)c(-c4ccc(N)cc4)c4nc(c(-c5ccc(N)cc5)c5ccc2[n-]5)C=C4)C=C3)cc1.[Cu+2] |
| InChI | InChI=1S/C44H32N8.Cu/c45-29-9-1-25(2-10-29)41-33-17-19-35(49-33)42(26-3-11-30(46)12-4-26)37-21-23-39(51-37)44(28-7-15-32(48)16-8-28)40-24-22-38(52-40)43(36-20-18-34(41)50-36)27-5-13-31(47)14-6-27;/h1-24H,45-48H2;/q-2;+2/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40-; |
| InChIKey | KGRSBJAKIMRVEC-DAJBKUBHSA-N |
| XLogP | 8.91 |
| TPSA | 158.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.34 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|