C44H24Cl4N4Ni — CID 12073187
nickel(2+);5,10,15,20-tetrakis(4-chlorophenyl)porphyrin-22,24-diide (PubChem CID 12073187) has the molecular formula C44H24Cl4N4Ni and a molecular weight of 809.21 g/mol. Its IUPAC name is nickel(2+);5,10,15,20-tetrakis(4-chlorophenyl)porphyrin-22,24-diide.
| Compound Name | nickel(2+);5,10,15,20-tetrakis(4-chlorophenyl)porphyrin-22,24-diide |
|---|---|
| PubChem CID | 12073187 |
| Molecular Formula | C44H24Cl4N4Ni |
| Molecular Weight | 809.21 g/mol |
| Exact Mass | 806.01 |
| IUPAC Name | nickel(2+);5,10,15,20-tetrakis(4-chlorophenyl)porphyrin-22,24-diide |
| SMILES | Clc1ccc(-c2c3nc(c(-c4ccc(Cl)cc4)c4ccc([n-]4)c(-c4ccc(Cl)cc4)c4nc(c(-c5ccc(Cl)cc5)c5ccc2[n-]5)C=C4)C=C3)cc1.[Ni+2] |
| InChI | InChI=1S/C44H24Cl4N4.Ni/c45-29-9-1-25(2-10-29)41-33-17-19-35(49-33)42(26-3-11-30(46)12-4-26)37-21-23-39(51-37)44(28-7-15-32(48)16-8-28)40-24-22-38(52-40)43(36-20-18-34(41)50-36)27-5-13-31(47)14-6-27;/h1-24H;/q-2;+2/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40-; |
| InChIKey | IKQQPOVAVATOON-DAJBKUBHSA-N |
| XLogP | 13.19 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.21 |
| LogP ≤ 5 | 13.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |