C62H48Cl2N4O2Ti — CID 11251694
1,2-bis(4-chlorophenyl)ethane-1,2-diol;5,10,15,20-tetrakis(4-methylphenyl)porphyrin-22,24-diide;titanium(2+) (PubChem CID 11251694) has the molecular formula C62H48Cl2N4O2Ti and a molecular weight of 999.87 g/mol. Its IUPAC name is 1,2-bis(4-chlorophenyl)ethane-1,2-diol;5,10,15,20-tetrakis(4-methylphenyl)porphyrin-22,24-diide;titanium(2+).
| Compound Name | 1,2-bis(4-chlorophenyl)ethane-1,2-diol;5,10,15,20-tetrakis(4-methylphenyl)porphyrin-22,24-diide;titanium(2+) |
|---|---|
| PubChem CID | 11251694 |
| Molecular Formula | C62H48Cl2N4O2Ti |
| Molecular Weight | 999.87 g/mol |
| Exact Mass | 998.26 |
| IUPAC Name | 1,2-bis(4-chlorophenyl)ethane-1,2-diol;5,10,15,20-tetrakis(4-methylphenyl)porphyrin-22,24-diide;titanium(2+) |
| SMILES | Cc1ccc(-c2c3nc(c(-c4ccc(C)cc4)c4ccc([n-]4)c(-c4ccc(C)cc4)c4nc(c(-c5ccc(C)cc5)c5ccc2[n-]5)C=C4)C=C3)cc1.OC(c1ccc(Cl)cc1)C(O)c1ccc(Cl)cc1.[Ti+2] |
| InChI | InChI=1S/C48H36N4.C14H12Cl2O2.Ti/c1-29-5-13-33(14-6-29)45-37-21-23-39(49-37)46(34-15-7-30(2)8-16-34)41-25-27-43(51-41)48(36-19-11-32(4)12-20-36)44-28-26-42(52-44)47(40-24-22-38(45)50-40)35-17-9-31(3)10-18-35;15-11-5-1-9(2-6-11)13(17)14(18)10-3-7-12(16)8-4-10;/h5-28H,1-4H3;1-8,13-14,17-18H;/q-2;;+2/b45-37-,45-38-,46-39-,46-41-,47-40-,47-42-,48-43-,48-44-;; |
| InChIKey | JPQQYOQPRXCZFB-HTMHXADGSA-N |
| XLogP | 15.57 |
| TPSA | 94.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 999.87 |
| LogP ≤ 5 | 15.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |