C43H32N4Zn — CID 11250914
zinc 5-ethenyl-10,15,20-tris(4-methylphenyl)porphyrin-22,24-diide (PubChem CID 11250914) has the molecular formula C43H32N4Zn and a molecular weight of 670.15 g/mol. Its IUPAC name is zinc 5-ethenyl-10,15,20-tris(4-methylphenyl)porphyrin-22,24-diide.
| Compound Name | zinc 5-ethenyl-10,15,20-tris(4-methylphenyl)porphyrin-22,24-diide |
|---|---|
| PubChem CID | 11250914 |
| Molecular Formula | C43H32N4Zn |
| Molecular Weight | 670.15 g/mol |
| Exact Mass | 668.19 |
| IUPAC Name | zinc 5-ethenyl-10,15,20-tris(4-methylphenyl)porphyrin-22,24-diide |
| SMILES | C=Cc1c2nc(c(-c3ccc(C)cc3)c3ccc([n-]3)c(-c3ccc(C)cc3)c3nc(c(-c4ccc(C)cc4)c4ccc1[n-]4)C=C3)C=C2.[Zn+2] |
| InChI | InChI=1S/C43H32N4.Zn/c1-5-32-33-18-20-35(44-33)41(29-12-6-26(2)7-13-29)37-22-24-39(46-37)43(31-16-10-28(4)11-17-31)40-25-23-38(47-40)42(36-21-19-34(32)45-36)30-14-8-27(3)9-15-30;/h5-25H,1H2,2-4H3;/q-2;+2/b33-32-,34-32-,41-35-,41-37-,42-36-,42-38-,43-39-,43-40-; |
| InChIKey | GDINPRZEMYTGCI-VIQKNPDISA-N |
| XLogP | 10.48 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.15 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|