C50H54N4Ni — CID 11513340
5,15-bis(3,5-ditert-butylphenyl)-10-ethenylporphyrin-22,24-diide;nickel(2+) (PubChem CID 11513340) has the molecular formula C50H54N4Ni and a molecular weight of 769.70 g/mol. Its IUPAC name is 5,15-bis(3,5-ditert-butylphenyl)-10-ethenylporphyrin-22,24-diide;nickel(2+).
| Compound Name | 5,15-bis(3,5-ditert-butylphenyl)-10-ethenylporphyrin-22,24-diide;nickel(2+) |
|---|---|
| PubChem CID | 11513340 |
| Molecular Formula | C50H54N4Ni |
| Molecular Weight | 769.70 g/mol |
| Exact Mass | 768.37 |
| IUPAC Name | 5,15-bis(3,5-ditert-butylphenyl)-10-ethenylporphyrin-22,24-diide;nickel(2+) |
| SMILES | C=Cc1c2nc(c(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)c3ccc(cc4nc(c(-c5cc(C(C)(C)C)cc(C(C)(C)C)c5)c5ccc1[n-]5)C=C4)[n-]3)C=C2.[Ni+2] |
| InChI | InChI=1S/C50H54N4.Ni/c1-14-38-39-19-21-43(53-39)45(30-23-32(47(2,3)4)27-33(24-30)48(5,6)7)41-17-15-36(51-41)29-37-16-18-42(52-37)46(44-22-20-40(38)54-44)31-25-34(49(8,9)10)28-35(26-31)50(11,12)13;/h14-29H,1H2,2-13H3;/q-2;+2/b36-29-,37-29-,39-38-,40-38-,45-41-,45-43-,46-42-,46-44-; |
| InChIKey | VEVKISOUVUPAFR-PIDBOACSSA-N |
| XLogP | 13.08 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.70 |
| LogP ≤ 5 | 13.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |