C42H41IN4OZn — CID 15975643
zinc 10-(3,5-ditert-butylphenyl)-15-(4-iodophenyl)-3,3-dimethyl-2H-porphyrin-22,23-diid-2-ol (PubChem CID 15975643) has the molecular formula C42H41IN4OZn and a molecular weight of 810.11 g/mol. Its IUPAC name is zinc 10-(3,5-ditert-butylphenyl)-15-(4-iodophenyl)-3,3-dimethyl-2H-porphyrin-22,23-diid-2-ol.
| Compound Name | zinc 10-(3,5-ditert-butylphenyl)-15-(4-iodophenyl)-3,3-dimethyl-2H-porphyrin-22,23-diid-2-ol |
|---|---|
| PubChem CID | 15975643 |
| Molecular Formula | C42H41IN4OZn |
| Molecular Weight | 810.11 g/mol |
| Exact Mass | 808.16 |
| IUPAC Name | zinc 10-(3,5-ditert-butylphenyl)-15-(4-iodophenyl)-3,3-dimethyl-2H-porphyrin-22,23-diid-2-ol |
| SMILES | CC(C)(C)c1cc(-c2c3ccc(cc4nc(cc5nc(c(-c6ccc(I)cc6)c6ccc2[n-]6)C=C5)C(O)C4(C)C)[n-]3)cc(C(C)(C)C)c1.[Zn+2] |
| InChI | InChI=1S/C42H41IN4O.Zn/c1-40(2,3)26-19-25(20-27(21-26)41(4,5)6)38-32-16-14-30(45-32)23-36-42(7,8)39(48)35(47-36)22-29-13-15-31(44-29)37(33-17-18-34(38)46-33)24-9-11-28(43)12-10-24;/h9-23,39,48H,1-8H3;/q-2;+2/b29-22-,30-23-,35-22-,36-23-,37-31-,37-33-,38-32-,38-34-; |
| InChIKey | COBTWOXHHYIOKG-FZBUECOFSA-N |
| XLogP | 10.29 |
| TPSA | 74.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.11 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|