C30H26CuN4O2S — CID 15969677
copper 3,3-dimethyl-10-(4-methylphenyl)-15-methylsulfonyl-2H-porphyrin-22,23-diide (PubChem CID 15969677) has the molecular formula C30H26CuN4O2S and a molecular weight of 570.18 g/mol. Its IUPAC name is copper 3,3-dimethyl-10-(4-methylphenyl)-15-methylsulfonyl-2H-porphyrin-22,23-diide.
| Compound Name | copper 3,3-dimethyl-10-(4-methylphenyl)-15-methylsulfonyl-2H-porphyrin-22,23-diide |
|---|---|
| PubChem CID | 15969677 |
| Molecular Formula | C30H26CuN4O2S |
| Molecular Weight | 570.18 g/mol |
| Exact Mass | 569.11 |
| IUPAC Name | copper 3,3-dimethyl-10-(4-methylphenyl)-15-methylsulfonyl-2H-porphyrin-22,23-diide |
| SMILES | Cc1ccc(-c2c3ccc(cc4nc(cc5nc(c(S(C)(=O)=O)c6ccc2[n-]6)C=C5)CC4(C)C)[n-]3)cc1.[Cu+2] |
| InChI | InChI=1S/C30H26N4O2S.Cu/c1-18-5-7-19(8-6-18)28-23-11-9-21(31-23)16-27-30(2,3)17-22(33-27)15-20-10-12-25(32-20)29(37(4,35)36)26-14-13-24(28)34-26;/h5-16H,17H2,1-4H3;/q-2;+2/b20-15-,21-16-,22-15-,27-16-,28-23-,28-24-,29-25+,29-26+; |
| InChIKey | JSJOGXBYKMMTMM-NTXMSEGPSA-N |
| XLogP | 5.64 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.18 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |