C43H45N4O3PZn — CID 45257559
zinc 15-[4-[bis[(2-methylpropan-2-yl)oxy]phosphoryl]phenyl]-3,3-dimethyl-10-(4-methylphenyl)-2H-porphyrin-22,23-diide (PubChem CID 45257559) has the molecular formula C43H45N4O3PZn and a molecular weight of 762.22 g/mol. Its IUPAC name is zinc 15-[4-[bis[(2-methylpropan-2-yl)oxy]phosphoryl]phenyl]-3,3-dimethyl-10-(4-methylphenyl)-2H-porphyrin-22,23-diide.
| Compound Name | zinc 15-[4-[bis[(2-methylpropan-2-yl)oxy]phosphoryl]phenyl]-3,3-dimethyl-10-(4-methylphenyl)-2H-porphyrin-22,23-diide |
|---|---|
| PubChem CID | 45257559 |
| Molecular Formula | C43H45N4O3PZn |
| Molecular Weight | 762.22 g/mol |
| Exact Mass | 760.25 |
| IUPAC Name | zinc 15-[4-[bis[(2-methylpropan-2-yl)oxy]phosphoryl]phenyl]-3,3-dimethyl-10-(4-methylphenyl)-2H-porphyrin-22,23-diide |
| SMILES | Cc1ccc(-c2c3ccc(cc4nc(cc5nc(c(-c6ccc(P(=O)(OC(C)(C)C)OC(C)(C)C)cc6)c6ccc2[n-]6)C=C5)CC4(C)C)[n-]3)cc1.[Zn+2] |
| InChI | InChI=1S/C43H45N4O3P.Zn/c1-27-10-12-28(13-11-27)39-35-21-17-31(45-35)25-38-43(8,9)26-32(46-38)24-30-16-20-34(44-30)40(37-23-22-36(39)47-37)29-14-18-33(19-15-29)51(48,49-41(2,3)4)50-42(5,6)7;/h10-25H,26H2,1-9H3;/q-2;+2/b30-24-,31-25-,32-24-,38-25-,39-35-,39-36-,40-34-,40-37-; |
| InChIKey | CLNDKEDYFLDDEH-FGUPSBLHSA-N |
| XLogP | 10.35 |
| TPSA | 89.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.22 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|