C31H28N4Zn — CID 164676402
zinc 3,3-dimethyl-15-(2,4,6-trimethylphenyl)-2H-porphyrin-22,24-diide (PubChem CID 164676402) has the molecular formula C31H28N4Zn and a molecular weight of 521.98 g/mol. Its IUPAC name is zinc 3,3-dimethyl-15-(2,4,6-trimethylphenyl)-2H-porphyrin-22,24-diide.
| Compound Name | zinc 3,3-dimethyl-15-(2,4,6-trimethylphenyl)-2H-porphyrin-22,24-diide |
|---|---|
| PubChem CID | 164676402 |
| Molecular Formula | C31H28N4Zn |
| Molecular Weight | 521.98 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | zinc 3,3-dimethyl-15-(2,4,6-trimethylphenyl)-2H-porphyrin-22,24-diide |
| SMILES | Cc1cc(C)c(-c2c3nc(cc4ccc(cc5nc(cc6ccc2[n-]6)CC5(C)C)[n-]4)C=C3)c(C)c1.[Zn+2] |
| InChI | InChI=1S/C31H28N4.Zn/c1-18-12-19(2)29(20(3)13-18)30-26-10-8-22(33-26)14-21-6-7-24(32-21)16-28-31(4,5)17-25(35-28)15-23-9-11-27(30)34-23;/h6-16H,17H2,1-5H3;/q-2;+2/b21-14-,22-14-,23-15-,24-16-,25-15-,28-16-,30-26+,30-27+; |
| InChIKey | QPGLRHNVVLVSBB-XHPRAZBGSA-N |
| XLogP | 6.85 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.98 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|