C39H32CuN4O — CID 11319652
copper 10,20-bis(2,4,6-trimethylphenyl)porphyrin-22,24-diide-5-carbaldehyde (PubChem CID 11319652) has the molecular formula C39H32CuN4O and a molecular weight of 636.26 g/mol. Its IUPAC name is copper 10,20-bis(2,4,6-trimethylphenyl)porphyrin-22,24-diide-5-carbaldehyde.
| Compound Name | copper 10,20-bis(2,4,6-trimethylphenyl)porphyrin-22,24-diide-5-carbaldehyde |
|---|---|
| PubChem CID | 11319652 |
| Molecular Formula | C39H32CuN4O |
| Molecular Weight | 636.26 g/mol |
| Exact Mass | 635.19 |
| IUPAC Name | copper 10,20-bis(2,4,6-trimethylphenyl)porphyrin-22,24-diide-5-carbaldehyde |
| SMILES | Cc1cc(C)c(-c2c3nc(c(C=O)c4ccc([n-]4)c(-c4c(C)cc(C)cc4C)c4nc(cc5ccc2[n-]5)C=C4)C=C3)c(C)c1.[Cu+2] |
| InChI | InChI=1S/C39H33N4O.Cu/c1-21-15-23(3)36(24(4)16-21)38-32-9-7-27(40-32)19-28-8-10-33(41-28)39(37-25(5)17-22(2)18-26(37)6)35-14-12-31(43-35)29(20-44)30-11-13-34(38)42-30;/h7-20H,1-6H3,(H-,40,41,42,43,44);/q-1;+2/p-1/b27-19-,28-19-,30-29-,31-29-,38-32+,38-34+,39-33+,39-35+; |
| InChIKey | DRPYKARXQVVCQR-WMRGHVPQSA-M |
| XLogP | 8.91 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.26 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|