C38H34N4Zn — CID 15975354
zinc 3,3-dimethyl-10-(4-methylphenyl)-15-(2,4,6-trimethylphenyl)-2H-porphyrin-22,23-diide (PubChem CID 15975354) has the molecular formula C38H34N4Zn and a molecular weight of 612.11 g/mol. Its IUPAC name is zinc 3,3-dimethyl-10-(4-methylphenyl)-15-(2,4,6-trimethylphenyl)-2H-porphyrin-22,23-diide.
| Compound Name | zinc 3,3-dimethyl-10-(4-methylphenyl)-15-(2,4,6-trimethylphenyl)-2H-porphyrin-22,23-diide |
|---|---|
| PubChem CID | 15975354 |
| Molecular Formula | C38H34N4Zn |
| Molecular Weight | 612.11 g/mol |
| Exact Mass | 610.21 |
| IUPAC Name | zinc 3,3-dimethyl-10-(4-methylphenyl)-15-(2,4,6-trimethylphenyl)-2H-porphyrin-22,23-diide |
| SMILES | Cc1ccc(-c2c3ccc(cc4nc(cc5nc(c(-c6c(C)cc(C)cc6C)c6ccc2[n-]6)C=C5)CC4(C)C)[n-]3)cc1.[Zn+2] |
| InChI | InChI=1S/C38H34N4.Zn/c1-22-7-9-26(10-8-22)36-30-13-12-28(40-30)20-34-38(5,6)21-29(41-34)19-27-11-14-32(39-27)37(33-16-15-31(36)42-33)35-24(3)17-23(2)18-25(35)4;/h7-20H,21H2,1-6H3;/q-2;+2/b27-19-,28-20-,29-19-,34-20-,36-30-,36-31-,37-32+,37-33+; |
| InChIKey | XVWSBZBCQKJZBA-DJYCRTGNSA-N |
| XLogP | 8.83 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.11 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|