C68H75CuIN4O — CID 135480498
copper 5,10,20-tris(3,5-ditert-butylphenyl)-15-(4-iodophenyl)porphyrin-21,23-diid-2-ol (PubChem CID 135480498) has the molecular formula C68H75CuIN4O and a molecular weight of 1154.82 g/mol. Its IUPAC name is copper 5,10,20-tris(3,5-ditert-butylphenyl)-15-(4-iodophenyl)porphyrin-21,23-diid-2-ol.
| Compound Name | copper 5,10,20-tris(3,5-ditert-butylphenyl)-15-(4-iodophenyl)porphyrin-21,23-diid-2-ol |
|---|---|
| PubChem CID | 135480498 |
| Molecular Formula | C68H75CuIN4O |
| Molecular Weight | 1154.82 g/mol |
| Exact Mass | 1153.43 |
| IUPAC Name | copper 5,10,20-tris(3,5-ditert-butylphenyl)-15-(4-iodophenyl)porphyrin-21,23-diid-2-ol |
| SMILES | CC(C)(C)c1cc(-c2c3nc(c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4cc(O)c([n-]4)c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4nc(c(-c5ccc(I)cc5)c5ccc2[n-]5)C=C4)C=C3)cc(C(C)(C)C)c1.[Cu+2] |
| InChI | InChI=1S/C68H75IN4O.Cu/c1-63(2,3)43-29-40(30-44(35-43)64(4,5)6)59-52-24-23-50(70-52)58(39-19-21-49(69)22-20-39)51-27-28-55(72-51)61(42-33-47(67(13,14)15)37-48(34-42)68(16,17)18)62-57(74)38-56(73-62)60(54-26-25-53(59)71-54)41-31-45(65(7,8)9)36-46(32-41)66(10,11)12;/h19-38H,1-18H3,(H-2,70,71,72,73,74);/q-2;+2/b58-50-,58-51-,59-52-,59-53-,60-54-,60-56-,61-55-,62-61-; |
| InChIKey | XZJCTCOQUXKMJS-FNLNJBHISA-N |
| XLogP | 18.67 |
| TPSA | 74.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1154.82 |
| LogP ≤ 5 | 18.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|