C56H60N4NiO4 — CID 11650908
methyl (E)-3-[10,20-bis(3,5-ditert-butylphenyl)-15-[(E)-3-methoxy-3-oxoprop-1-enyl]porphyrin-22,24-diid-5-yl]prop-2-enoate;nickel(2+) (PubChem CID 11650908) has the molecular formula C56H60N4NiO4 and a molecular weight of 911.81 g/mol. Its IUPAC name is methyl (E)-3-[10,20-bis(3,5-ditert-butylphenyl)-15-[(E)-3-methoxy-3-oxoprop-1-enyl]porphyrin-22,24-diid-5-yl]prop-2-enoate;nickel(2+).
| Compound Name | methyl (E)-3-[10,20-bis(3,5-ditert-butylphenyl)-15-[(E)-3-methoxy-3-oxoprop-1-enyl]porphyrin-22,24-diid-5-yl]prop-2-enoate;nickel(2+) |
|---|---|
| PubChem CID | 11650908 |
| Molecular Formula | C56H60N4NiO4 |
| Molecular Weight | 911.81 g/mol |
| Exact Mass | 910.40 |
| IUPAC Name | methyl (E)-3-[10,20-bis(3,5-ditert-butylphenyl)-15-[(E)-3-methoxy-3-oxoprop-1-enyl]porphyrin-22,24-diid-5-yl]prop-2-enoate;nickel(2+) |
| SMILES | COC(=O)/C=C/c1c2nc(c(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)c3ccc([n-]3)c(/C=C/C(=O)OC)c3nc(c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4ccc1[n-]4)C=C3)C=C2.[Ni+2] |
| InChI | InChI=1S/C56H61N4O4.Ni/c1-53(2,3)35-27-33(28-36(31-35)54(4,5)6)51-45-21-17-41(57-45)39(15-25-49(61)63-13)43-19-23-47(59-43)52(34-29-37(55(7,8)9)32-38(30-34)56(10,11)12)48-24-20-44(60-48)40(16-26-50(62)64-14)42-18-22-46(51)58-42;/h15-32H,1-14H3,(H-,57,58,59,60,61,62);/q-1;+2/p-1/b41-39-,42-40-,43-39-,44-40-,51-45-,51-46-,52-47-,52-48-; |
| InChIKey | DTAPIFDIBVEWEY-MISNULRESA-M |
| XLogP | 12.81 |
| TPSA | 106.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.81 |
| LogP ≤ 5 | 12.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|