C41H25ClN4NiO — CID 135872704
nickel(2+);(E)-3-(10,15,20-triphenylporphyrin-22,24-diid-5-yl)prop-2-enoyl chloride (PubChem CID 135872704) has the molecular formula C41H25ClN4NiO and a molecular weight of 683.82 g/mol. Its IUPAC name is nickel(2+);(E)-3-(10,15,20-triphenylporphyrin-22,24-diid-5-yl)prop-2-enoyl chloride.
| Compound Name | nickel(2+);(E)-3-(10,15,20-triphenylporphyrin-22,24-diid-5-yl)prop-2-enoyl chloride |
|---|---|
| PubChem CID | 135872704 |
| Molecular Formula | C41H25ClN4NiO |
| Molecular Weight | 683.82 g/mol |
| Exact Mass | 682.11 |
| IUPAC Name | nickel(2+);(E)-3-(10,15,20-triphenylporphyrin-22,24-diid-5-yl)prop-2-enoyl chloride |
| SMILES | O=C(Cl)/C=C/c1c2nc(c(-c3ccccc3)c3ccc([n-]3)c(-c3ccccc3)c3nc(c(-c4ccccc4)c4ccc1[n-]4)C=C3)C=C2.[Ni+2] |
| InChI | InChI=1S/C41H26ClN4O.Ni/c42-38(47)25-16-29-30-17-19-32(43-30)39(26-10-4-1-5-11-26)34-21-23-36(45-34)41(28-14-8-3-9-15-28)37-24-22-35(46-37)40(27-12-6-2-7-13-27)33-20-18-31(29)44-33;/h1-25H,(H-,43,44,45,46,47);/q-1;+2/p-1/b30-29-,31-29-,39-32-,39-34-,40-33-,40-35-,41-36-,41-37-; |
| InChIKey | UMBVUINLBKNAMX-BKBPEZLESA-M |
| XLogP | 9.69 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.82 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|