C45H28N4NiO — CID 146020185
nickel(2+);2-(10,15,20-triphenylporphyrin-22,24-diid-5-yl)benzaldehyde (PubChem CID 146020185) has the molecular formula C45H28N4NiO and a molecular weight of 699.44 g/mol. Its IUPAC name is nickel(2+);2-(10,15,20-triphenylporphyrin-22,24-diid-5-yl)benzaldehyde.
| Compound Name | nickel(2+);2-(10,15,20-triphenylporphyrin-22,24-diid-5-yl)benzaldehyde |
|---|---|
| PubChem CID | 146020185 |
| Molecular Formula | C45H28N4NiO |
| Molecular Weight | 699.44 g/mol |
| Exact Mass | 698.16 |
| IUPAC Name | nickel(2+);2-(10,15,20-triphenylporphyrin-22,24-diid-5-yl)benzaldehyde |
| SMILES | O=Cc1ccccc1-c1c2nc(c(-c3ccccc3)c3ccc([n-]3)c(-c3ccccc3)c3nc(c(-c4ccccc4)c4ccc1[n-]4)C=C3)C=C2.[Ni+2] |
| InChI | InChI=1S/C45H29N4O.Ni/c50-28-32-18-10-11-19-33(32)45-40-26-24-38(48-40)43(30-14-6-2-7-15-30)36-22-20-34(46-36)42(29-12-4-1-5-13-29)35-21-23-37(47-35)44(31-16-8-3-9-17-31)39-25-27-41(45)49-39;/h1-28H,(H-,46,47,48,49,50);/q-1;+2/p-1/b42-34-,42-35-,43-36-,43-38-,44-37-,44-39-,45-40-,45-41-; |
| InChIKey | PNJCQSRZVFLATK-RORYYHOOSA-M |
| XLogP | 10.39 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.44 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|