C76H46N8Zn2 — CID 134908932
dizinc;5,10,15-triphenyl-20-(10,15,20-triphenylporphyrin-22,24-diid-5-yl)porphyrin-22,24-diide (PubChem CID 134908932) has the molecular formula C76H46N8Zn2 and a molecular weight of 1202.04 g/mol. Its IUPAC name is dizinc;5,10,15-triphenyl-20-(10,15,20-triphenylporphyrin-22,24-diid-5-yl)porphyrin-22,24-diide.
| Compound Name | dizinc;5,10,15-triphenyl-20-(10,15,20-triphenylporphyrin-22,24-diid-5-yl)porphyrin-22,24-diide |
|---|---|
| PubChem CID | 134908932 |
| Molecular Formula | C76H46N8Zn2 |
| Molecular Weight | 1202.04 g/mol |
| Exact Mass | 1198.24 |
| IUPAC Name | dizinc;5,10,15-triphenyl-20-(10,15,20-triphenylporphyrin-22,24-diid-5-yl)porphyrin-22,24-diide |
| SMILES | C1=Cc2nc1c(-c1ccccc1)c1ccc([n-]1)c(-c1ccccc1)c1nc(c(-c3c4nc(c(-c5ccccc5)c5ccc([n-]5)c(-c5ccccc5)c5nc(c(-c6ccccc6)c6ccc3[n-]6)C=C5)C=C4)c3ccc([n-]3)c2-c2ccccc2)C=C1.[Zn+2].[Zn+2] |
| InChI | InChI=1S/C76H46N8.2Zn/c1-7-19-47(20-8-1)69-53-31-35-57(77-53)71(49-23-11-3-12-24-49)61-39-43-65(81-61)75(66-44-40-62(82-66)72(50-25-13-4-14-26-50)58-36-32-54(69)78-58)76-67-45-41-63(83-67)73(51-27-15-5-16-28-51)59-37-33-55(79-59)70(48-21-9-2-10-22-48)56-34-38-60(80-56)74(52-29-17-6-18-30-52)64-42-46-68(76)84-64;;/h1-46H;;/q-4;2*+2/b69-53-,69-54-,70-55-,70-56-,71-57-,71-61-,72-58-,72-62-,73-59-,73-63-,74-60-,74-64-,75-65+,75-66+,76-67+,76-68+;; |
| InChIKey | GEATZRAYTDJLAU-HWNMUZRGSA-N |
| XLogP | 17.81 |
| TPSA | 107.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 86 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1202.04 |
| LogP ≤ 5 | 17.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|