C45H30N4Zn — CID 10032590
zinc 2-methyl-5,10,15,20-tetraphenylporphyrin-22,24-diide (PubChem CID 10032590) has the molecular formula C45H30N4Zn and a molecular weight of 692.15 g/mol. Its IUPAC name is zinc 2-methyl-5,10,15,20-tetraphenylporphyrin-22,24-diide.
| Compound Name | zinc 2-methyl-5,10,15,20-tetraphenylporphyrin-22,24-diide |
|---|---|
| PubChem CID | 10032590 |
| Molecular Formula | C45H30N4Zn |
| Molecular Weight | 692.15 g/mol |
| Exact Mass | 690.18 |
| IUPAC Name | zinc 2-methyl-5,10,15,20-tetraphenylporphyrin-22,24-diide |
| SMILES | CC1=Cc2nc1c(-c1ccccc1)c1ccc([n-]1)c(-c1ccccc1)c1nc(c(-c3ccccc3)c3ccc([n-]3)c2-c2ccccc2)C=C1.[Zn+2] |
| InChI | InChI=1S/C45H30N4.Zn/c1-29-28-40-43(32-18-10-4-11-19-32)38-25-24-36(47-38)41(30-14-6-2-7-15-30)34-22-23-35(46-34)42(31-16-8-3-9-17-31)37-26-27-39(48-37)44(45(29)49-40)33-20-12-5-13-21-33;/h2-28H,1H3;/q-2;+2/b41-34-,41-36-,42-35-,42-37-,43-38-,43-40-,44-39-,45-44-; |
| InChIKey | STNRXPVOGMFGLG-BUNRFVFMSA-N |
| XLogP | 10.97 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.15 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|