C48H36N4Ni — CID 10327576
2-butyl-5,10,15,20-tetraphenylporphyrin-22,24-diide;nickel(2+) (PubChem CID 10327576) has the molecular formula C48H36N4Ni and a molecular weight of 727.54 g/mol. Its IUPAC name is 2-butyl-5,10,15,20-tetraphenylporphyrin-22,24-diide;nickel(2+).
| Compound Name | 2-butyl-5,10,15,20-tetraphenylporphyrin-22,24-diide;nickel(2+) |
|---|---|
| PubChem CID | 10327576 |
| Molecular Formula | C48H36N4Ni |
| Molecular Weight | 727.54 g/mol |
| Exact Mass | 726.23 |
| IUPAC Name | 2-butyl-5,10,15,20-tetraphenylporphyrin-22,24-diide;nickel(2+) |
| SMILES | CCCCC1=Cc2nc1c(-c1ccccc1)c1ccc([n-]1)c(-c1ccccc1)c1nc(c(-c3ccccc3)c3ccc([n-]3)c2-c2ccccc2)C=C1.[Ni+2] |
| InChI | InChI=1S/C48H36N4.Ni/c1-2-3-16-36-31-43-46(34-21-12-6-13-22-34)41-28-27-39(50-41)44(32-17-8-4-9-18-32)37-25-26-38(49-37)45(33-19-10-5-11-20-33)40-29-30-42(51-40)47(48(36)52-43)35-23-14-7-15-24-35;/h4-15,17-31H,2-3,16H2,1H3;/q-2;+2/b44-37-,44-39-,45-38-,45-40-,46-41-,46-43-,47-42-,48-47-; |
| InChIKey | AOVFHUBLTVPXOC-RIRHRYGJSA-N |
| XLogP | 12.14 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.54 |
| LogP ≤ 5 | 12.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |