C50H32ClN5Ni — CID 25098994
N-(4-chlorophenyl)-5,10,15,20-tetraphenylporphyrin-22,24-diid-2-amine;nickel(2+) (PubChem CID 25098994) has the molecular formula C50H32ClN5Ni and a molecular weight of 796.99 g/mol. Its IUPAC name is N-(4-chlorophenyl)-5,10,15,20-tetraphenylporphyrin-22,24-diid-2-amine;nickel(2+).
| Compound Name | N-(4-chlorophenyl)-5,10,15,20-tetraphenylporphyrin-22,24-diid-2-amine;nickel(2+) |
|---|---|
| PubChem CID | 25098994 |
| Molecular Formula | C50H32ClN5Ni |
| Molecular Weight | 796.99 g/mol |
| Exact Mass | 795.17 |
| IUPAC Name | N-(4-chlorophenyl)-5,10,15,20-tetraphenylporphyrin-22,24-diid-2-amine;nickel(2+) |
| SMILES | Clc1ccc(NC2=Cc3nc2c(-c2ccccc2)c2ccc([n-]2)c(-c2ccccc2)c2nc(c(-c4ccccc4)c4ccc([n-]4)c3-c3ccccc3)C=C2)cc1.[Ni+2] |
| InChI | InChI=1S/C50H32ClN5.Ni/c51-36-21-23-37(24-22-36)52-45-31-44-48(34-17-9-3-10-18-34)42-28-27-40(54-42)46(32-13-5-1-6-14-32)38-25-26-39(53-38)47(33-15-7-2-8-16-33)41-29-30-43(55-41)49(50(45)56-44)35-19-11-4-12-20-35;/h1-31,52H;/q-2;+2/b46-38-,46-40-,47-39-,47-41-,48-42-,48-44-,49-43-,50-49-; |
| InChIKey | QSTCMLGTOJSFFS-FEUHDWRMSA-N |
| XLogP | 12.67 |
| TPSA | 66.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.99 |
| LogP ≤ 5 | 12.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |