C40H36N4Ni — CID 11114854
5,15-dibutyl-10,20-diphenylporphyrin-22,24-diide;nickel(2+) (PubChem CID 11114854) has the molecular formula C40H36N4Ni and a molecular weight of 631.45 g/mol. Its IUPAC name is 5,15-dibutyl-10,20-diphenylporphyrin-22,24-diide;nickel(2+).
| Compound Name | 5,15-dibutyl-10,20-diphenylporphyrin-22,24-diide;nickel(2+) |
|---|---|
| PubChem CID | 11114854 |
| Molecular Formula | C40H36N4Ni |
| Molecular Weight | 631.45 g/mol |
| Exact Mass | 630.23 |
| IUPAC Name | 5,15-dibutyl-10,20-diphenylporphyrin-22,24-diide;nickel(2+) |
| SMILES | CCCCc1c2nc(c(-c3ccccc3)c3ccc([n-]3)c(CCCC)c3nc(c(-c4ccccc4)c4ccc1[n-]4)C=C3)C=C2.[Ni+2] |
| InChI | InChI=1S/C40H36N4.Ni/c1-3-5-17-29-31-19-23-35(41-31)39(27-13-9-7-10-14-27)37-25-21-33(43-37)30(18-6-4-2)34-22-26-38(44-34)40(28-15-11-8-12-16-28)36-24-20-32(29)42-36;/h7-16,19-26H,3-6,17-18H2,1-2H3;/q-2;+2/b31-29-,32-29-,33-30-,34-30-,39-35-,39-37-,40-36-,40-38-; |
| InChIKey | GOHJWISRWFDGKA-QUEJNXPWSA-N |
| XLogP | 9.93 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.45 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |