C38H31BrN4O2Zn — CID 56651772
zinc 5-bromo-15-butyl-10,20-bis(3-methoxyphenyl)porphyrin-22,24-diide (PubChem CID 56651772) has the molecular formula C38H31BrN4O2Zn and a molecular weight of 720.99 g/mol. Its IUPAC name is zinc 5-bromo-15-butyl-10,20-bis(3-methoxyphenyl)porphyrin-22,24-diide.
| Compound Name | zinc 5-bromo-15-butyl-10,20-bis(3-methoxyphenyl)porphyrin-22,24-diide |
|---|---|
| PubChem CID | 56651772 |
| Molecular Formula | C38H31BrN4O2Zn |
| Molecular Weight | 720.99 g/mol |
| Exact Mass | 718.09 |
| IUPAC Name | zinc 5-bromo-15-butyl-10,20-bis(3-methoxyphenyl)porphyrin-22,24-diide |
| SMILES | CCCCc1c2nc(c(-c3cccc(OC)c3)c3ccc([n-]3)c(Br)c3nc(c(-c4cccc(OC)c4)c4ccc1[n-]4)C=C3)C=C2.[Zn+2] |
| InChI | InChI=1S/C38H31BrN4O2.Zn/c1-4-5-12-27-28-13-15-30(40-28)36(23-8-6-10-25(21-23)44-2)32-17-19-34(42-32)38(39)35-20-18-33(43-35)37(31-16-14-29(27)41-31)24-9-7-11-26(22-24)45-3;/h6-11,13-22H,4-5,12H2,1-3H3;/q-2;+2/b28-27-,29-27-,36-30-,36-32-,37-31-,37-33-,38-34+,38-35+; |
| InChIKey | YDDOQTDREVXZDF-MLEZPWQSSA-N |
| XLogP | 9.37 |
| TPSA | 72.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.99 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|