C24H35NO2 — CID 22005048
[4-(3-methoxyphenyl)-5-pentyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol (PubChem CID 22005048) has the molecular formula C24H35NO2 and a molecular weight of 369.55 g/mol. Its IUPAC name is [4-(3-methoxyphenyl)-5-pentyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol.
| Compound Name | [4-(3-methoxyphenyl)-5-pentyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 22005048 |
| Molecular Formula | C24H35NO2 |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.27 |
| IUPAC Name | [4-(3-methoxyphenyl)-5-pentyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol |
| SMILES | CCCCCc1c(C(C)C)nc(C(C)C)c(CO)c1-c1cccc(OC)c1 |
| InChI | InChI=1S/C24H35NO2/c1-7-8-9-13-20-22(18-11-10-12-19(14-18)27-6)21(15-26)24(17(4)5)25-23(20)16(2)3/h10-12,14,16-17,26H,7-9,13,15H2,1-6H3 |
| InChIKey | YXNKGSVXMGLJSF-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|