C28H42FNO — CID 54328042
[4-[2-(2-fluoropentan-3-yl)phenyl]-5-pentyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol (PubChem CID 54328042) has the molecular formula C28H42FNO and a molecular weight of 427.65 g/mol. Its IUPAC name is [4-[2-(2-fluoropentan-3-yl)phenyl]-5-pentyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol.
| Compound Name | [4-[2-(2-fluoropentan-3-yl)phenyl]-5-pentyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 54328042 |
| Molecular Formula | C28H42FNO |
| Molecular Weight | 427.65 g/mol |
| Exact Mass | 427.33 |
| IUPAC Name | [4-[2-(2-fluoropentan-3-yl)phenyl]-5-pentyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol |
| SMILES | CCCCCc1c(C(C)C)nc(C(C)C)c(CO)c1-c1ccccc1C(CC)C(C)F |
| InChI | InChI=1S/C28H42FNO/c1-8-10-11-16-24-26(23-15-13-12-14-22(23)21(9-2)20(7)29)25(17-31)28(19(5)6)30-27(24)18(3)4/h12-15,18-21,31H,8-11,16-17H2,1-7H3 |
| InChIKey | SWIUDNHADVDOOT-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.65 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|