C25H35FN2O2 — CID 22005376
[4-(4-fluorophenyl)-6-(morpholin-4-ylmethyl)-5-pentyl-2-propan-2-yl-3-pyridinyl]methanol (PubChem CID 22005376) has the molecular formula C25H35FN2O2 and a molecular weight of 414.57 g/mol. Its IUPAC name is [4-(4-fluorophenyl)-6-(morpholin-4-ylmethyl)-5-pentyl-2-propan-2-yl-3-pyridinyl]methanol.
| Compound Name | [4-(4-fluorophenyl)-6-(morpholin-4-ylmethyl)-5-pentyl-2-propan-2-yl-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 22005376 |
| Molecular Formula | C25H35FN2O2 |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | [4-(4-fluorophenyl)-6-(morpholin-4-ylmethyl)-5-pentyl-2-propan-2-yl-3-pyridinyl]methanol |
| SMILES | CCCCCc1c(CN2CCOCC2)nc(C(C)C)c(CO)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C25H35FN2O2/c1-4-5-6-7-21-23(16-28-12-14-30-15-13-28)27-25(18(2)3)22(17-29)24(21)19-8-10-20(26)11-9-19/h8-11,18,29H,4-7,12-17H2,1-3H3 |
| InChIKey | YLTINRDNAQSQPF-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|