C39H50FNO2Si — CID 22005138
2-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(4-fluorophenyl)-3-pentyl-6-propan-2-yl-2-pyridinyl]propan-2-ol (PubChem CID 22005138) has the molecular formula C39H50FNO2Si and a molecular weight of 611.92 g/mol. Its IUPAC name is 2-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(4-fluorophenyl)-3-pentyl-6-propan-2-yl-2-pyridinyl]propan-2-ol.
| Compound Name | 2-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(4-fluorophenyl)-3-pentyl-6-propan-2-yl-2-pyridinyl]propan-2-ol |
|---|---|
| PubChem CID | 22005138 |
| Molecular Formula | C39H50FNO2Si |
| Molecular Weight | 611.92 g/mol |
| Exact Mass | 611.36 |
| IUPAC Name | 2-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(4-fluorophenyl)-3-pentyl-6-propan-2-yl-2-pyridinyl]propan-2-ol |
| SMILES | CCCCCc1c(C(C)(C)O)nc(C(C)C)c(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C39H50FNO2Si/c1-9-10-13-22-33-35(29-23-25-30(40)26-24-29)34(36(28(2)3)41-37(33)39(7,8)42)27-43-44(38(4,5)6,31-18-14-11-15-19-31)32-20-16-12-17-21-32/h11-12,14-21,23-26,28,42H,9-10,13,22,27H2,1-8H3 |
| InChIKey | DUXZAPYYWXSQET-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.92 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|