C23H31FO — CID 22005025
[3-butyl-2-(4-fluorophenyl)-4,6-di(propan-2-yl)phenyl]methanol (PubChem CID 22005025) has the molecular formula C23H31FO and a molecular weight of 342.50 g/mol. Its IUPAC name is [3-butyl-2-(4-fluorophenyl)-4,6-di(propan-2-yl)phenyl]methanol.
| Compound Name | [3-butyl-2-(4-fluorophenyl)-4,6-di(propan-2-yl)phenyl]methanol |
|---|---|
| PubChem CID | 22005025 |
| Molecular Formula | C23H31FO |
| Molecular Weight | 342.50 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | [3-butyl-2-(4-fluorophenyl)-4,6-di(propan-2-yl)phenyl]methanol |
| SMILES | CCCCc1c(C(C)C)cc(C(C)C)c(CO)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C23H31FO/c1-6-7-8-19-20(15(2)3)13-21(16(4)5)22(14-25)23(19)17-9-11-18(24)12-10-17/h9-13,15-16,25H,6-8,14H2,1-5H3 |
| InChIKey | VYBLFXLXIQJOAU-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.50 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |