C23H32O2 — CID 22005018
2-[2-butyl-6-(hydroxymethyl)-3,5-di(propan-2-yl)phenyl]phenol (PubChem CID 22005018) has the molecular formula C23H32O2 and a molecular weight of 340.51 g/mol. Its IUPAC name is 2-[2-butyl-6-(hydroxymethyl)-3,5-di(propan-2-yl)phenyl]phenol.
| Compound Name | 2-[2-butyl-6-(hydroxymethyl)-3,5-di(propan-2-yl)phenyl]phenol |
|---|---|
| PubChem CID | 22005018 |
| Molecular Formula | C23H32O2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 2-[2-butyl-6-(hydroxymethyl)-3,5-di(propan-2-yl)phenyl]phenol |
| SMILES | CCCCc1c(C(C)C)cc(C(C)C)c(CO)c1-c1ccccc1O |
| InChI | InChI=1S/C23H32O2/c1-6-7-10-17-19(15(2)3)13-20(16(4)5)21(14-24)23(17)18-11-8-9-12-22(18)25/h8-9,11-13,15-16,24-25H,6-7,10,14H2,1-5H3 |
| InChIKey | HMUKSMDZJHETDO-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |