C24H34O2 — CID 22005139
2-[2-(hydroxymethyl)-6-pentyl-3,5-di(propan-2-yl)phenyl]phenol (PubChem CID 22005139) has the molecular formula C24H34O2 and a molecular weight of 354.53 g/mol. Its IUPAC name is 2-[2-(hydroxymethyl)-6-pentyl-3,5-di(propan-2-yl)phenyl]phenol.
| Compound Name | 2-[2-(hydroxymethyl)-6-pentyl-3,5-di(propan-2-yl)phenyl]phenol |
|---|---|
| PubChem CID | 22005139 |
| Molecular Formula | C24H34O2 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | 2-[2-(hydroxymethyl)-6-pentyl-3,5-di(propan-2-yl)phenyl]phenol |
| SMILES | CCCCCc1c(C(C)C)cc(C(C)C)c(CO)c1-c1ccccc1O |
| InChI | InChI=1S/C24H34O2/c1-6-7-8-11-18-20(16(2)3)14-21(17(4)5)22(15-25)24(18)19-12-9-10-13-23(19)26/h9-10,12-14,16-17,25-26H,6-8,11,15H2,1-5H3 |
| InChIKey | MWVCACJLNJUMHL-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|