C17H19FN2O2 — CID 54316367
[4-(4-fluorophenyl)-6-methyl-5-(nitrosomethyl)-2-propan-2-yl-3-pyridinyl]methanol (PubChem CID 54316367) has the molecular formula C17H19FN2O2 and a molecular weight of 302.35 g/mol. Its IUPAC name is [4-(4-fluorophenyl)-6-methyl-5-(nitrosomethyl)-2-propan-2-yl-3-pyridinyl]methanol.
| Compound Name | [4-(4-fluorophenyl)-6-methyl-5-(nitrosomethyl)-2-propan-2-yl-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 54316367 |
| Molecular Formula | C17H19FN2O2 |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | [4-(4-fluorophenyl)-6-methyl-5-(nitrosomethyl)-2-propan-2-yl-3-pyridinyl]methanol |
| SMILES | Cc1nc(C(C)C)c(CO)c(-c2ccc(F)cc2)c1CN=O |
| InChI | InChI=1S/C17H19FN2O2/c1-10(2)17-15(9-21)16(12-4-6-13(18)7-5-12)14(8-19-22)11(3)20-17/h4-7,10,21H,8-9H2,1-3H3 |
| InChIKey | SOLYGCBOHIFRJH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |