C22H30FNO2 — CID 22005370
4-[4-(4-fluorophenyl)-5-(hydroxymethyl)-2,6-di(propan-2-yl)-3-pyridinyl]butan-1-ol (PubChem CID 22005370) has the molecular formula C22H30FNO2 and a molecular weight of 359.49 g/mol. Its IUPAC name is 4-[4-(4-fluorophenyl)-5-(hydroxymethyl)-2,6-di(propan-2-yl)-3-pyridinyl]butan-1-ol.
| Compound Name | 4-[4-(4-fluorophenyl)-5-(hydroxymethyl)-2,6-di(propan-2-yl)-3-pyridinyl]butan-1-ol |
|---|---|
| PubChem CID | 22005370 |
| Molecular Formula | C22H30FNO2 |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | 4-[4-(4-fluorophenyl)-5-(hydroxymethyl)-2,6-di(propan-2-yl)-3-pyridinyl]butan-1-ol |
| SMILES | CC(C)c1nc(C(C)C)c(CCCCO)c(-c2ccc(F)cc2)c1CO |
| InChI | InChI=1S/C22H30FNO2/c1-14(2)21-18(7-5-6-12-25)20(16-8-10-17(23)11-9-16)19(13-26)22(24-21)15(3)4/h8-11,14-15,25-26H,5-7,12-13H2,1-4H3 |
| InChIKey | FEPCCUBKWYZMTI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|