C29H45FN2O2Si — CID 56984254
1-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(4-fluorophenyl)-2,6-di(propan-2-yl)-3-pyridinyl]-N-[(2-methylpropan-2-yl)oxy]methanimine (PubChem CID 56984254) has the molecular formula C29H45FN2O2Si and a molecular weight of 500.78 g/mol. Its IUPAC name is 1-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(4-fluorophenyl)-2,6-di(propan-2-yl)-3-pyridinyl]-N-[(2-methylpropan-2-yl)oxy]methanimine.
| Compound Name | 1-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(4-fluorophenyl)-2,6-di(propan-2-yl)-3-pyridinyl]-N-[(2-methylpropan-2-yl)oxy]methanimine |
|---|---|
| PubChem CID | 56984254 |
| Molecular Formula | C29H45FN2O2Si |
| Molecular Weight | 500.78 g/mol |
| Exact Mass | 500.32 |
| IUPAC Name | 1-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(4-fluorophenyl)-2,6-di(propan-2-yl)-3-pyridinyl]-N-[(2-methylpropan-2-yl)oxy]methanimine |
| SMILES | CC(C)c1nc(C(C)C)c(CO[Si](C)(C)C(C)(C)C)c(-c2ccc(F)cc2)c1C=NOC(C)(C)C |
| InChI | InChI=1S/C29H45FN2O2Si/c1-19(2)26-23(17-31-34-28(5,6)7)25(21-13-15-22(30)16-14-21)24(27(32-26)20(3)4)18-33-35(11,12)29(8,9)10/h13-17,19-20H,18H2,1-12H3 |
| InChIKey | OFERLRCZJPQKED-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 43.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.78 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|