C29H42FN3OSSi — CID 57198125
[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(4-fluorophenyl)-2,6-di(propan-2-yl)-3-pyridinyl]-(1-methylimidazol-2-yl)methanethiol (PubChem CID 57198125) has the molecular formula C29H42FN3OSSi and a molecular weight of 527.83 g/mol. Its IUPAC name is [5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(4-fluorophenyl)-2,6-di(propan-2-yl)-3-pyridinyl]-(1-methylimidazol-2-yl)methanethiol.
| Compound Name | [5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(4-fluorophenyl)-2,6-di(propan-2-yl)-3-pyridinyl]-(1-methylimidazol-2-yl)methanethiol |
|---|---|
| PubChem CID | 57198125 |
| Molecular Formula | C29H42FN3OSSi |
| Molecular Weight | 527.83 g/mol |
| Exact Mass | 527.28 |
| IUPAC Name | [5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(4-fluorophenyl)-2,6-di(propan-2-yl)-3-pyridinyl]-(1-methylimidazol-2-yl)methanethiol |
| SMILES | CC(C)c1nc(C(C)C)c(C(S)c2nccn2C)c(-c2ccc(F)cc2)c1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H42FN3OSSi/c1-18(2)25-22(17-34-36(9,10)29(5,6)7)23(20-11-13-21(30)14-12-20)24(26(32-25)19(3)4)27(35)28-31-15-16-33(28)8/h11-16,18-19,27,35H,17H2,1-10H3 |
| InChIKey | OGLIIRVMKXJYES-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 39.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.83 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|