C11H11FN2O — CID 26722436
(S)-(4-fluorophenyl)-(1-methylimidazol-2-yl)methanol (PubChem CID 26722436) has the molecular formula C11H11FN2O and a molecular weight of 206.22 g/mol. Its IUPAC name is (S)-(4-fluorophenyl)-(1-methylimidazol-2-yl)methanol.
| Compound Name | (S)-(4-fluorophenyl)-(1-methylimidazol-2-yl)methanol |
|---|---|
| PubChem CID | 26722436 |
| Molecular Formula | C11H11FN2O |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (S)-(4-fluorophenyl)-(1-methylimidazol-2-yl)methanol |
| SMILES | Cn1ccnc1[C@@H](O)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H11FN2O/c1-14-7-6-13-11(14)10(15)8-2-4-9(12)5-3-8/h2-7,10,15H,1H3/t10-/m0/s1 |
| InChIKey | KJCSIXINJKNLAE-JTQLQIEISA-N |
| XLogP | 1.64 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |