C18H24FN3O2 — CID 75434389
1-(4-fluorophenyl)-2-[4-[hydroxy-(1-methylimidazol-2-yl)methyl]piperidin-1-yl]ethanol (PubChem CID 75434389) has the molecular formula C18H24FN3O2 and a molecular weight of 333.41 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2-[4-[hydroxy-(1-methylimidazol-2-yl)methyl]piperidin-1-yl]ethanol.
| Compound Name | 1-(4-fluorophenyl)-2-[4-[hydroxy-(1-methylimidazol-2-yl)methyl]piperidin-1-yl]ethanol |
|---|---|
| PubChem CID | 75434389 |
| Molecular Formula | C18H24FN3O2 |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 1-(4-fluorophenyl)-2-[4-[hydroxy-(1-methylimidazol-2-yl)methyl]piperidin-1-yl]ethanol |
| SMILES | Cn1ccnc1C(O)C1CCN(CC(O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H24FN3O2/c1-21-11-8-20-18(21)17(24)14-6-9-22(10-7-14)12-16(23)13-2-4-15(19)5-3-13/h2-5,8,11,14,16-17,23-24H,6-7,9-10,12H2,1H3 |
| InChIKey | JIVUHKNUVDOAKT-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |