C17H21ClFN3O — CID 77078802
[1-[(2-chloro-4-fluorophenyl)methyl]piperidin-4-yl]-(1-methylimidazol-2-yl)methanol (PubChem CID 77078802) has the molecular formula C17H21ClFN3O and a molecular weight of 337.83 g/mol. Its IUPAC name is [1-[(2-chloro-4-fluorophenyl)methyl]piperidin-4-yl]-(1-methylimidazol-2-yl)methanol.
| Compound Name | [1-[(2-chloro-4-fluorophenyl)methyl]piperidin-4-yl]-(1-methylimidazol-2-yl)methanol |
|---|---|
| PubChem CID | 77078802 |
| Molecular Formula | C17H21ClFN3O |
| Molecular Weight | 337.83 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | [1-[(2-chloro-4-fluorophenyl)methyl]piperidin-4-yl]-(1-methylimidazol-2-yl)methanol |
| SMILES | Cn1ccnc1C(O)C1CCN(Cc2ccc(F)cc2Cl)CC1 |
| InChI | InChI=1S/C17H21ClFN3O/c1-21-9-6-20-17(21)16(23)12-4-7-22(8-5-12)11-13-2-3-14(19)10-15(13)18/h2-3,6,9-10,12,16,23H,4-5,7-8,11H2,1H3 |
| InChIKey | MSHVJYDJKUWBGQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.83 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |