C19H29N3OS — CID 124516622
(R)-[1-[(5-tert-butylthiophen-2-yl)methyl]piperidin-4-yl]-(1-methylimidazol-2-yl)methanol (PubChem CID 124516622) has the molecular formula C19H29N3OS and a molecular weight of 347.53 g/mol. Its IUPAC name is (R)-[1-[(5-tert-butylthiophen-2-yl)methyl]piperidin-4-yl]-(1-methylimidazol-2-yl)methanol.
| Compound Name | (R)-[1-[(5-tert-butylthiophen-2-yl)methyl]piperidin-4-yl]-(1-methylimidazol-2-yl)methanol |
|---|---|
| PubChem CID | 124516622 |
| Molecular Formula | C19H29N3OS |
| Molecular Weight | 347.53 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | (R)-[1-[(5-tert-butylthiophen-2-yl)methyl]piperidin-4-yl]-(1-methylimidazol-2-yl)methanol |
| SMILES | Cn1ccnc1[C@H](O)C1CCN(Cc2ccc(C(C)(C)C)s2)CC1 |
| InChI | InChI=1S/C19H29N3OS/c1-19(2,3)16-6-5-15(24-16)13-22-10-7-14(8-11-22)17(23)18-20-9-12-21(18)4/h5-6,9,12,14,17,23H,7-8,10-11,13H2,1-4H3/t17-/m1/s1 |
| InChIKey | DBGUWJCIQQQSMC-QGZVFWFLSA-N |
| XLogP | 3.72 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.53 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |