C26H21FN2O2 — CID 132532355
2-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-1,3-diphenylpropane-1,3-dione (PubChem CID 132532355) has the molecular formula C26H21FN2O2 and a molecular weight of 412.46 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-1,3-diphenylpropane-1,3-dione.
| Compound Name | 2-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-1,3-diphenylpropane-1,3-dione |
|---|---|
| PubChem CID | 132532355 |
| Molecular Formula | C26H21FN2O2 |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 2-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-1,3-diphenylpropane-1,3-dione |
| SMILES | Cn1ccnc1C(c1ccc(F)cc1)C(C(=O)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C26H21FN2O2/c1-29-17-16-28-26(29)22(18-12-14-21(27)15-13-18)23(24(30)19-8-4-2-5-9-19)25(31)20-10-6-3-7-11-20/h2-17,22-23H,1H3 |
| InChIKey | GMXBEUFXUZZIRD-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|